C22H38O2Si — CID 170547678
(2E,4E,6S,7S,8R,10E,12E)-7-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyltetradeca-2,4,10,12-tetraenal (PubChem CID 170547678) has the molecular formula C22H38O2Si and a molecular weight of 362.63 g/mol. Its IUPAC name is (2E,4E,6S,7S,8R,10E,12E)-7-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyltetradeca-2,4,10,12-tetraenal.
| Compound Name | (2E,4E,6S,7S,8R,10E,12E)-7-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyltetradeca-2,4,10,12-tetraenal |
|---|---|
| PubChem CID | 170547678 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | (2E,4E,6S,7S,8R,10E,12E)-7-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyltetradeca-2,4,10,12-tetraenal |
| SMILES | C/C=C/C=C/C[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C/C=C/C=O |
| InChI | InChI=1S/C22H38O2Si/c1-9-10-11-13-16-19(2)21(20(3)17-14-12-15-18-23)24-25(7,8)22(4,5)6/h9-15,17-21H,16H2,1-8H3/b10-9+,13-11+,15-12+,17-14+/t19-,20+,21+/m1/s1 |
| InChIKey | LSFUAEYNMWJUAM-KNCUCHQPSA-N |
| XLogP | 6.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|