C20H36O2Si — CID 170547680
(2E,4S,5S,6R,8E,10E)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyldodeca-2,8,10-trienal (PubChem CID 170547680) has the molecular formula C20H36O2Si and a molecular weight of 336.59 g/mol. Its IUPAC name is (2E,4S,5S,6R,8E,10E)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyldodeca-2,8,10-trienal.
| Compound Name | (2E,4S,5S,6R,8E,10E)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyldodeca-2,8,10-trienal |
|---|---|
| PubChem CID | 170547680 |
| Molecular Formula | C20H36O2Si |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | (2E,4S,5S,6R,8E,10E)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethyldodeca-2,8,10-trienal |
| SMILES | C/C=C/C=C/C[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C/C=O |
| InChI | InChI=1S/C20H36O2Si/c1-9-10-11-12-14-17(2)19(18(3)15-13-16-21)22-23(7,8)20(4,5)6/h9-13,15-19H,14H2,1-8H3/b10-9+,12-11+,15-13+/t17-,18+,19+/m1/s1 |
| InChIKey | VBVIAKCVMVHQPM-LQLWUCOCSA-N |
| XLogP | 5.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|