C27H30F5N5O3 — CID 170547981
5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-(2,2,3,3,3-pentafluoropropyl)-4-[4-(piperidin-1-ylmethyl)phenyl]-1,2,4-triazole-3-carboxamide (PubChem CID 170547981) has the molecular formula C27H30F5N5O3 and a molecular weight of 567.56 g/mol. Its IUPAC name is 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-(2,2,3,3,3-pentafluoropropyl)-4-[4-(piperidin-1-ylmethyl)phenyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-(2,2,3,3,3-pentafluoropropyl)-4-[4-(piperidin-1-ylmethyl)phenyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 170547981 |
| Molecular Formula | C27H30F5N5O3 |
| Molecular Weight | 567.56 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-N-(2,2,3,3,3-pentafluoropropyl)-4-[4-(piperidin-1-ylmethyl)phenyl]-1,2,4-triazole-3-carboxamide |
| SMILES | CC(C)c1cc(-c2nnc(C(=O)NCC(F)(F)C(F)(F)F)n2-c2ccc(CN3CCCCC3)cc2)c(O)cc1O |
| InChI | InChI=1S/C27H30F5N5O3/c1-16(2)19-12-20(22(39)13-21(19)38)23-34-35-24(25(40)33-15-26(28,29)27(30,31)32)37(23)18-8-6-17(7-9-18)14-36-10-4-3-5-11-36/h6-9,12-13,16,38-39H,3-5,10-11,14-15H2,1-2H3,(H,33,40) |
| InChIKey | ULAZXUSZYLUOPA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|