C33H38BClN4O4 — CID 170548388
tert-butyl 7-[4-(2-chlorophenyl)-3-cyano-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]-2,7-diazaspiro[3.4]octane-2-carboxylate (PubChem CID 170548388) has the molecular formula C33H38BClN4O4 and a molecular weight of 600.96 g/mol. Its IUPAC name is tert-butyl 7-[4-(2-chlorophenyl)-3-cyano-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]-2,7-diazaspiro[3.4]octane-2-carboxylate.
| Compound Name | tert-butyl 7-[4-(2-chlorophenyl)-3-cyano-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]-2,7-diazaspiro[3.4]octane-2-carboxylate |
|---|---|
| PubChem CID | 170548388 |
| Molecular Formula | C33H38BClN4O4 |
| Molecular Weight | 600.96 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | tert-butyl 7-[4-(2-chlorophenyl)-3-cyano-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]-2,7-diazaspiro[3.4]octane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCN(c3nc4cc(B5OC(C)(C)C(C)(C)O5)ccc4c(-c4ccccc4Cl)c3C#N)C2)C1 |
| InChI | InChI=1S/C33H38BClN4O4/c1-30(2,3)41-29(40)39-19-33(20-39)14-15-38(18-33)28-24(17-36)27(22-10-8-9-11-25(22)35)23-13-12-21(16-26(23)37-28)34-42-31(4,5)32(6,7)43-34/h8-13,16H,14-15,18-20H2,1-7H3 |
| InChIKey | NSVCSDJZWJGKSX-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 87.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.96 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|