C29H38ClN3O4 — CID 170548447
tert-butyl 7-[4-(2-chloro-5-hydroxy-3-methylphenyl)-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridin-2-yl]-2,7-diazaspiro[3.4]octane-2-carboxylate (PubChem CID 170548447) has the molecular formula C29H38ClN3O4 and a molecular weight of 528.09 g/mol. Its IUPAC name is tert-butyl 7-[4-(2-chloro-5-hydroxy-3-methylphenyl)-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridin-2-yl]-2,7-diazaspiro[3.4]octane-2-carboxylate.
| Compound Name | tert-butyl 7-[4-(2-chloro-5-hydroxy-3-methylphenyl)-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridin-2-yl]-2,7-diazaspiro[3.4]octane-2-carboxylate |
|---|---|
| PubChem CID | 170548447 |
| Molecular Formula | C29H38ClN3O4 |
| Molecular Weight | 528.09 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | tert-butyl 7-[4-(2-chloro-5-hydroxy-3-methylphenyl)-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridin-2-yl]-2,7-diazaspiro[3.4]octane-2-carboxylate |
| SMILES | Cc1cc(O)cc(-c2c(C)c(N3CCC4(CN(C(=O)OC(C)(C)C)C4)C3)nc3c2COC(C)(C)C3)c1Cl |
| InChI | InChI=1S/C29H38ClN3O4/c1-17-10-19(34)11-20(24(17)30)23-18(2)25(31-22-12-28(6,7)36-13-21(22)23)32-9-8-29(14-32)15-33(16-29)26(35)37-27(3,4)5/h10-11,34H,8-9,12-16H2,1-7H3 |
| InChIKey | FIXFOABKWZARMF-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.09 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |