C27H35BN4O4 — CID 170548608
tert-butyl 7-[3-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]-2,7-diazaspiro[3.4]octane-2-carboxylate (PubChem CID 170548608) has the molecular formula C27H35BN4O4 and a molecular weight of 490.41 g/mol. Its IUPAC name is tert-butyl 7-[3-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]-2,7-diazaspiro[3.4]octane-2-carboxylate.
| Compound Name | tert-butyl 7-[3-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]-2,7-diazaspiro[3.4]octane-2-carboxylate |
|---|---|
| PubChem CID | 170548608 |
| Molecular Formula | C27H35BN4O4 |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | tert-butyl 7-[3-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]-2,7-diazaspiro[3.4]octane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCN(c3nc4ccccc4c(B4OC(C)(C)C(C)(C)O4)c3C#N)C2)C1 |
| InChI | InChI=1S/C27H35BN4O4/c1-24(2,3)34-23(33)32-16-27(17-32)12-13-31(15-27)22-19(14-29)21(18-10-8-9-11-20(18)30-22)28-35-25(4,5)26(6,7)36-28/h8-11H,12-13,15-17H2,1-7H3 |
| InChIKey | MNIZCZDELXTNER-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 87.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|