About 2-bromo-5-(oxan-4-yloxy)pyridine;6-bromopyridin-3-ol
2-bromo-5-(oxan-4-yloxy)pyridine;6-bromopyridin-3-ol (PubChem CID 170549224) has the molecular formula C15H16Br2N2O3
and a molecular weight of 432.11 g/mol. Its IUPAC name is 2-bromo-5-(oxan-4-yloxy)pyridine;6-bromopyridin-3-ol.
Molecular Properties
| Compound Name | 2-bromo-5-(oxan-4-yloxy)pyridine;6-bromopyridin-3-ol |
| PubChem CID | 170549224 |
| Molecular Formula | C15H16Br2N2O3 |
| Molecular Weight | 432.11 g/mol |
| Exact Mass | 429.95 |
| IUPAC Name | 2-bromo-5-(oxan-4-yloxy)pyridine;6-bromopyridin-3-ol |
| SMILES | Brc1ccc(OC2CCOCC2)cn1.Oc1ccc(Br)nc1 |
| InChI | InChI=1S/C10H12BrNO2.C5H4BrNO/c11-10-2-1-9(7-12-10)14-8-3-5-13-6-4-8;6-5-2-1-4(8)3-7-5/h1-2,7-8H,3-6H2;1-3,8H |
| InChIKey | JAZCFEPIVZXJHB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.11 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-(oxan-4-yloxy)pyridine;6-bromopyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-(oxan-4-yloxy)pyridine;6-bromopyridin-3-ol?
The IUPAC name of 2-bromo-5-(oxan-4-yloxy)pyridine;6-bromopyridin-3-ol (CID 170549224) is 2-bromo-5-(oxan-4-yloxy)pyridine;6-bromopyridin-3-ol.
What is the SMILES notation for 2-bromo-5-(oxan-4-yloxy)pyridine;6-bromopyridin-3-ol?
The canonical SMILES for 2-bromo-5-(oxan-4-yloxy)pyridine;6-bromopyridin-3-ol is Brc1ccc(OC2CCOCC2)cn1.Oc1ccc(Br)nc1.
What is the InChIKey of 2-bromo-5-(oxan-4-yloxy)pyridine;6-bromopyridin-3-ol?
The InChIKey is JAZCFEPIVZXJHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrNO2.C5H4BrNO/c11-10-2-1-9(7-12-10)14-8-3-5-13-6-4-8;6-5-2-1-4(8)3-7-5/h1-2,7-8H,3-6H2;1-3,8H.
What are the key properties of 2-bromo-5-(oxan-4-yloxy)pyridine;6-bromopyridin-3-ol?
2-bromo-5-(oxan-4-yloxy)pyridine;6-bromopyridin-3-ol has a molecular weight of 432.11 g/mol, XLogP of 3.95, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-(oxan-4-yloxy)pyridine;6-bromopyridin-3-ol is sourced from PubChem (CID 170549224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).