C22H24ClF3N4O5 — CID 170549290
(2R,4R)-6-chloro-4-hydroxy-N-[3-[4-[3-(trifluoromethoxy)propoxyamino]pyrazol-1-yl]-1-bicyclo[1.1.1]pentanyl]-3,4-dihydro-2H-chromene-2-carboxamide (PubChem CID 170549290) has the molecular formula C22H24ClF3N4O5 and a molecular weight of 516.90 g/mol. Its IUPAC name is (2R,4R)-6-chloro-4-hydroxy-N-[3-[4-[3-(trifluoromethoxy)propoxyamino]pyrazol-1-yl]-1-bicyclo[1.1.1]pentanyl]-3,4-dihydro-2H-chromene-2-carboxamide.
| Compound Name | (2R,4R)-6-chloro-4-hydroxy-N-[3-[4-[3-(trifluoromethoxy)propoxyamino]pyrazol-1-yl]-1-bicyclo[1.1.1]pentanyl]-3,4-dihydro-2H-chromene-2-carboxamide |
|---|---|
| PubChem CID | 170549290 |
| Molecular Formula | C22H24ClF3N4O5 |
| Molecular Weight | 516.90 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | (2R,4R)-6-chloro-4-hydroxy-N-[3-[4-[3-(trifluoromethoxy)propoxyamino]pyrazol-1-yl]-1-bicyclo[1.1.1]pentanyl]-3,4-dihydro-2H-chromene-2-carboxamide |
| SMILES | O=C(NC12CC(n3cc(NOCCCOC(F)(F)F)cn3)(C1)C2)[C@H]1C[C@@H](O)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C22H24ClF3N4O5/c23-13-2-3-17-15(6-13)16(31)7-18(35-17)19(32)28-20-10-21(11-20,12-20)30-9-14(8-27-30)29-34-5-1-4-33-22(24,25)26/h2-3,6,8-9,16,18,29,31H,1,4-5,7,10-12H2,(H,28,32)/t16-,18-,20?,21?/m1/s1 |
| InChIKey | TXOPPUNEHMOHMU-SPNPKDGLSA-N |
| XLogP | 3.44 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.90 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|