C13H26N2O3 — CID 170549425
ethyl N-[(3R,6S)-6-(aminomethyl)oxan-3-yl]-N-tert-butylcarbamate (PubChem CID 170549425) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is ethyl N-[(3R,6S)-6-(aminomethyl)oxan-3-yl]-N-tert-butylcarbamate.
| Compound Name | ethyl N-[(3R,6S)-6-(aminomethyl)oxan-3-yl]-N-tert-butylcarbamate |
|---|---|
| PubChem CID | 170549425 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | ethyl N-[(3R,6S)-6-(aminomethyl)oxan-3-yl]-N-tert-butylcarbamate |
| SMILES | CCOC(=O)N([C@@H]1CC[C@@H](CN)OC1)C(C)(C)C |
| InChI | InChI=1S/C13H26N2O3/c1-5-17-12(16)15(13(2,3)4)10-6-7-11(8-14)18-9-10/h10-11H,5-9,14H2,1-4H3/t10-,11+/m1/s1 |
| InChIKey | NJTFLVVQSGKPOD-MNOVXSKESA-N |
| XLogP | 1.75 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |