C14H15N3O2 — CID 170549447
2-(4-cyanophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid (PubChem CID 170549447) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-(4-cyanophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid.
| Compound Name | 2-(4-cyanophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 170549447 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-(4-cyanophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
| SMILES | N#Cc1ccc(N2CC3CN(C(=O)O)CC3C2)cc1 |
| InChI | InChI=1S/C14H15N3O2/c15-5-10-1-3-13(4-2-10)16-6-11-8-17(14(18)19)9-12(11)7-16/h1-4,11-12H,6-9H2,(H,18,19) |
| InChIKey | IXAPUNDVHAPIAO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |