C19H31ClN4OSi — CID 170549459
tert-butyl-[[(4S,6R)-13-tert-butyl-12-chloro-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),7,9,11-tetraen-4-yl]oxy]-dimethylsilane (PubChem CID 170549459) has the molecular formula C19H31ClN4OSi and a molecular weight of 395.02 g/mol. Its IUPAC name is tert-butyl-[[(4S,6R)-13-tert-butyl-12-chloro-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),7,9,11-tetraen-4-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(4S,6R)-13-tert-butyl-12-chloro-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),7,9,11-tetraen-4-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 170549459 |
| Molecular Formula | C19H31ClN4OSi |
| Molecular Weight | 395.02 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | tert-butyl-[[(4S,6R)-13-tert-butyl-12-chloro-2,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),7,9,11-tetraen-4-yl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)c1c(Cl)nnc2c1N1C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1C=N2 |
| InChI | InChI=1S/C19H31ClN4OSi/c1-18(2,3)14-15-17(23-22-16(14)20)21-10-12-9-13(11-24(12)15)25-26(7,8)19(4,5)6/h10,12-13H,9,11H2,1-8H3/t12-,13+/m1/s1 |
| InChIKey | CYVOMVZQZIKHLV-OLZOCXBDSA-N |
| XLogP | 5.11 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.02 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|