C12H15NO3 — CID 170549735
(3aS,7aS)-2-(propoxymethyl)-3a,7a-dihydroisoindole-1,3-dione (PubChem CID 170549735) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is (3aS,7aS)-2-(propoxymethyl)-3a,7a-dihydroisoindole-1,3-dione.
| Compound Name | (3aS,7aS)-2-(propoxymethyl)-3a,7a-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 170549735 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (3aS,7aS)-2-(propoxymethyl)-3a,7a-dihydroisoindole-1,3-dione |
| SMILES | CCCOCN1C(=O)[C@H]2C=CC=C[C@@H]2C1=O |
| InChI | InChI=1S/C12H15NO3/c1-2-7-16-8-13-11(14)9-5-3-4-6-10(9)12(13)15/h3-6,9-10H,2,7-8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | OQAURBYIJSZFPL-UWVGGRQHSA-N |
| XLogP | 1.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|