C28H23F4N7O3 — CID 170549859
[3-[[5-(4-cyclopropylphenyl)-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-4-fluoro-N-prop-2-enoylanilino] 2,2,2-trifluoroacetate (PubChem CID 170549859) has the molecular formula C28H23F4N7O3 and a molecular weight of 581.53 g/mol. Its IUPAC name is [3-[[5-(4-cyclopropylphenyl)-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-4-fluoro-N-prop-2-enoylanilino] 2,2,2-trifluoroacetate.
| Compound Name | [3-[[5-(4-cyclopropylphenyl)-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-4-fluoro-N-prop-2-enoylanilino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 170549859 |
| Molecular Formula | C28H23F4N7O3 |
| Molecular Weight | 581.53 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | [3-[[5-(4-cyclopropylphenyl)-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]-4-fluoro-N-prop-2-enoylanilino] 2,2,2-trifluoroacetate |
| SMILES | C=CC(=O)N(OC(=O)C(F)(F)F)c1ccc(F)c(Nc2nc(Nc3cnn(C)c3)ncc2-c2ccc(C3CC3)cc2)c1 |
| InChI | InChI=1S/C28H23F4N7O3/c1-3-24(40)39(42-26(41)28(30,31)32)20-10-11-22(29)23(12-20)36-25-21(18-8-6-17(7-9-18)16-4-5-16)14-33-27(37-25)35-19-13-34-38(2)15-19/h3,6-16H,1,4-5H2,2H3,(H2,33,35,36,37) |
| InChIKey | OUOVHPHQULNPSH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.53 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|