C11H19IMg — CID 170549986
magnesium;(4Z,6E)-undeca-4,6-diene;iodide (PubChem CID 170549986) has the molecular formula C11H19IMg and a molecular weight of 302.48 g/mol. Its IUPAC name is magnesium;(4Z,6E)-undeca-4,6-diene;iodide.
| Compound Name | magnesium;(4Z,6E)-undeca-4,6-diene;iodide |
|---|---|
| PubChem CID | 170549986 |
| Molecular Formula | C11H19IMg |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | magnesium;(4Z,6E)-undeca-4,6-diene;iodide |
| SMILES | [CH2-]CC/C=C\C=C\CCCC.[I-].[Mg+2] |
| InChI | InChI=1S/C11H19.HI.Mg/c1-3-5-7-9-11-10-8-6-4-2;;/h7,9-11H,1,3-6,8H2,2H3;1H;/q-1;;+2/p-1/b9-7-,11-10+;; |
| InChIKey | XEAUVCZHROMDLG-QRTWSPRLSA-M |
| XLogP | 0.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|