C21H31Cl2NO3Si — CID 170550441
1-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-3,4-dichloro-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-ol (PubChem CID 170550441) has the molecular formula C21H31Cl2NO3Si and a molecular weight of 444.48 g/mol. Its IUPAC name is 1-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-3,4-dichloro-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-ol.
| Compound Name | 1-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-3,4-dichloro-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-ol |
|---|---|
| PubChem CID | 170550441 |
| Molecular Formula | C21H31Cl2NO3Si |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 1-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-3,4-dichloro-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCCOc1cc(Cl)c(Cl)c2c1cc1n2CC(O)CC1 |
| InChI | InChI=1S/C21H31Cl2NO3Si/c1-21(2,3)28(4,5)27-10-6-9-26-18-12-17(22)19(23)20-16(18)11-14-7-8-15(25)13-24(14)20/h11-12,15,25H,6-10,13H2,1-5H3 |
| InChIKey | ADKCQKRBNJATPT-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|