About 2-[6,7-dichloro-3-iodo-1-(2-trimethylsilylethoxymethyl)indol-4-yl]oxyacetonitrile
2-[6,7-dichloro-3-iodo-1-(2-trimethylsilylethoxymethyl)indol-4-yl]oxyacetonitrile (PubChem CID 170550494) has the molecular formula C16H19Cl2IN2O2Si
and a molecular weight of 497.24 g/mol. Its IUPAC name is 2-[6,7-dichloro-3-iodo-1-(2-trimethylsilylethoxymethyl)indol-4-yl]oxyacetonitrile.
Molecular Properties
| Compound Name | 2-[6,7-dichloro-3-iodo-1-(2-trimethylsilylethoxymethyl)indol-4-yl]oxyacetonitrile |
| PubChem CID | 170550494 |
| Molecular Formula | C16H19Cl2IN2O2Si |
| Molecular Weight | 497.24 g/mol |
| Exact Mass | 495.96 |
| IUPAC Name | 2-[6,7-dichloro-3-iodo-1-(2-trimethylsilylethoxymethyl)indol-4-yl]oxyacetonitrile |
| SMILES | C[Si](C)(C)CCOCn1cc(I)c2c(OCC#N)cc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C16H19Cl2IN2O2Si/c1-24(2,3)7-6-22-10-21-9-12(19)14-13(23-5-4-20)8-11(17)15(18)16(14)21/h8-9H,5-7,10H2,1-3H3 |
| InChIKey | LWKFGBPKBXYQPT-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 47.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.24 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[6,7-dichloro-3-iodo-1-(2-trimethylsilylethoxymethyl)indol-4-yl]oxyacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6,7-dichloro-3-iodo-1-(2-trimethylsilylethoxymethyl)indol-4-yl]oxyacetonitrile?
The IUPAC name of 2-[6,7-dichloro-3-iodo-1-(2-trimethylsilylethoxymethyl)indol-4-yl]oxyacetonitrile (CID 170550494) is 2-[6,7-dichloro-3-iodo-1-(2-trimethylsilylethoxymethyl)indol-4-yl]oxyacetonitrile.
What is the SMILES notation for 2-[6,7-dichloro-3-iodo-1-(2-trimethylsilylethoxymethyl)indol-4-yl]oxyacetonitrile?
The canonical SMILES for 2-[6,7-dichloro-3-iodo-1-(2-trimethylsilylethoxymethyl)indol-4-yl]oxyacetonitrile is C[Si](C)(C)CCOCn1cc(I)c2c(OCC#N)cc(Cl)c(Cl)c21.
What is the InChIKey of 2-[6,7-dichloro-3-iodo-1-(2-trimethylsilylethoxymethyl)indol-4-yl]oxyacetonitrile?
The InChIKey is LWKFGBPKBXYQPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19Cl2IN2O2Si/c1-24(2,3)7-6-22-10-21-9-12(19)14-13(23-5-4-20)8-11(17)15(18)16(14)21/h8-9H,5-7,10H2,1-3H3.
What are the key properties of 2-[6,7-dichloro-3-iodo-1-(2-trimethylsilylethoxymethyl)indol-4-yl]oxyacetonitrile?
2-[6,7-dichloro-3-iodo-1-(2-trimethylsilylethoxymethyl)indol-4-yl]oxyacetonitrile has a molecular weight of 497.24 g/mol, XLogP of 5.77, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6,7-dichloro-3-iodo-1-(2-trimethylsilylethoxymethyl)indol-4-yl]oxyacetonitrile is sourced from PubChem (CID 170550494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).