C15H28N4O2SSi — CID 170550711
O-[[1-(2-trimethylsilylethoxymethyl)-4,5,6,7-tetrahydroindazol-4-yl]methyl] N-aminocarbamothioate (PubChem CID 170550711) has the molecular formula C15H28N4O2SSi and a molecular weight of 356.57 g/mol. Its IUPAC name is O-[[1-(2-trimethylsilylethoxymethyl)-4,5,6,7-tetrahydroindazol-4-yl]methyl] N-aminocarbamothioate.
| Compound Name | O-[[1-(2-trimethylsilylethoxymethyl)-4,5,6,7-tetrahydroindazol-4-yl]methyl] N-aminocarbamothioate |
|---|---|
| PubChem CID | 170550711 |
| Molecular Formula | C15H28N4O2SSi |
| Molecular Weight | 356.57 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | O-[[1-(2-trimethylsilylethoxymethyl)-4,5,6,7-tetrahydroindazol-4-yl]methyl] N-aminocarbamothioate |
| SMILES | C[Si](C)(C)CCOCn1ncc2c1CCCC2COC(=S)NN |
| InChI | InChI=1S/C15H28N4O2SSi/c1-23(2,3)8-7-20-11-19-14-6-4-5-12(13(14)9-17-19)10-21-15(22)18-16/h9,12H,4-8,10-11,16H2,1-3H3,(H,18,22) |
| InChIKey | LXWYUEDXYAOXBK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.57 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|