C16H28N2O2S2Si — CID 170550842
O-[[1-(2-trimethylsilylethoxymethyl)-4,5,6,7-tetrahydroindazol-4-yl]methyl] methylsulfanylmethanethioate (PubChem CID 170550842) has the molecular formula C16H28N2O2S2Si and a molecular weight of 372.63 g/mol. Its IUPAC name is O-[[1-(2-trimethylsilylethoxymethyl)-4,5,6,7-tetrahydroindazol-4-yl]methyl] methylsulfanylmethanethioate.
| Compound Name | O-[[1-(2-trimethylsilylethoxymethyl)-4,5,6,7-tetrahydroindazol-4-yl]methyl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 170550842 |
| Molecular Formula | C16H28N2O2S2Si |
| Molecular Weight | 372.63 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | O-[[1-(2-trimethylsilylethoxymethyl)-4,5,6,7-tetrahydroindazol-4-yl]methyl] methylsulfanylmethanethioate |
| SMILES | CSC(=S)OCC1CCCc2c1cnn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C16H28N2O2S2Si/c1-22-16(21)20-11-13-6-5-7-15-14(13)10-17-18(15)12-19-8-9-23(2,3)4/h10,13H,5-9,11-12H2,1-4H3 |
| InChIKey | KWEXKDXKMCXKJX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.63 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|