C23H26F4N6O4 — CID 170550933
ethyl 2-[2-[(S)-(4,4-difluorocyclohexyl)-[(4-methyl-1,2,5-oxadiazole-3-carbonyl)amino]methyl]imidazo[1,2-b]pyridazin-7-yl]-4,4-difluorobutanoate (PubChem CID 170550933) has the molecular formula C23H26F4N6O4 and a molecular weight of 526.49 g/mol. Its IUPAC name is ethyl 2-[2-[(S)-(4,4-difluorocyclohexyl)-[(4-methyl-1,2,5-oxadiazole-3-carbonyl)amino]methyl]imidazo[1,2-b]pyridazin-7-yl]-4,4-difluorobutanoate.
| Compound Name | ethyl 2-[2-[(S)-(4,4-difluorocyclohexyl)-[(4-methyl-1,2,5-oxadiazole-3-carbonyl)amino]methyl]imidazo[1,2-b]pyridazin-7-yl]-4,4-difluorobutanoate |
|---|---|
| PubChem CID | 170550933 |
| Molecular Formula | C23H26F4N6O4 |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | ethyl 2-[2-[(S)-(4,4-difluorocyclohexyl)-[(4-methyl-1,2,5-oxadiazole-3-carbonyl)amino]methyl]imidazo[1,2-b]pyridazin-7-yl]-4,4-difluorobutanoate |
| SMILES | CCOC(=O)C(CC(F)F)c1cnn2cc([C@@H](NC(=O)c3nonc3C)C3CCC(F)(F)CC3)nc2c1 |
| InChI | InChI=1S/C23H26F4N6O4/c1-3-36-22(35)15(9-17(24)25)14-8-18-29-16(11-33(18)28-10-14)20(13-4-6-23(26,27)7-5-13)30-21(34)19-12(2)31-37-32-19/h8,10-11,13,15,17,20H,3-7,9H2,1-2H3,(H,30,34)/t15?,20-/m0/s1 |
| InChIKey | KTAJFRZTROLIOQ-MBABXSBOSA-N |
| XLogP | 4.02 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |