4-fluoro-1,2-oxazole-3-carboxylic acid

C4H2FNO3 — CID 170551163

IUPAC4-fluoro-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1nocc1F
InChIInChI=1S/C4H2FNO3/c5-2-1-9-6-3(2)4(7)8/h1H,(H,7,8)
InChIKeySFXQPFNIGGDSHZ-UHFFFAOYSA-N
MW131.06 g/mol
LogP0.51
Rot. Bonds1

About 4-fluoro-1,2-oxazole-3-carboxylic acid

4-fluoro-1,2-oxazole-3-carboxylic acid (PubChem CID 170551163) has the molecular formula C4H2FNO3 and a molecular weight of 131.06 g/mol. Its IUPAC name is 4-fluoro-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name4-fluoro-1,2-oxazole-3-carboxylic acid
PubChem CID170551163
Molecular FormulaC4H2FNO3
Molecular Weight131.06 g/mol
Exact Mass131.00
IUPAC Name4-fluoro-1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1nocc1F
InChIInChI=1S/C4H2FNO3/c5-2-1-9-6-3(2)4(7)8/h1H,(H,7,8)
InChIKeySFXQPFNIGGDSHZ-UHFFFAOYSA-N
XLogP0.51
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500131.06
LogP ≤ 50.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-fluoro-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-fluoro-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 4-fluoro-1,2-oxazole-3-carboxylic acid (CID 170551163) is 4-fluoro-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 4-fluoro-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 4-fluoro-1,2-oxazole-3-carboxylic acid is O=C(O)c1nocc1F.
What is the InChIKey of 4-fluoro-1,2-oxazole-3-carboxylic acid?
The InChIKey is SFXQPFNIGGDSHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2FNO3/c5-2-1-9-6-3(2)4(7)8/h1H,(H,7,8).
What are the key properties of 4-fluoro-1,2-oxazole-3-carboxylic acid?
4-fluoro-1,2-oxazole-3-carboxylic acid has a molecular weight of 131.06 g/mol, XLogP of 0.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 170551163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).