About 4-fluoro-1,2-oxazole-3-carboxylic acid
4-fluoro-1,2-oxazole-3-carboxylic acid (PubChem CID 170551163) has the molecular formula C4H2FNO3
and a molecular weight of 131.06 g/mol. Its IUPAC name is 4-fluoro-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-fluoro-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 170551163 |
| Molecular Formula | C4H2FNO3 |
| Molecular Weight | 131.06 g/mol |
| Exact Mass | 131.00 |
| IUPAC Name | 4-fluoro-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1nocc1F |
| InChI | InChI=1S/C4H2FNO3/c5-2-1-9-6-3(2)4(7)8/h1H,(H,7,8) |
| InChIKey | SFXQPFNIGGDSHZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.06 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluoro-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 4-fluoro-1,2-oxazole-3-carboxylic acid (CID 170551163) is 4-fluoro-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 4-fluoro-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 4-fluoro-1,2-oxazole-3-carboxylic acid is O=C(O)c1nocc1F.
What is the InChIKey of 4-fluoro-1,2-oxazole-3-carboxylic acid?
The InChIKey is SFXQPFNIGGDSHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2FNO3/c5-2-1-9-6-3(2)4(7)8/h1H,(H,7,8).
What are the key properties of 4-fluoro-1,2-oxazole-3-carboxylic acid?
4-fluoro-1,2-oxazole-3-carboxylic acid has a molecular weight of 131.06 g/mol, XLogP of 0.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 170551163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).