C26H30ClF3N6O3 — CID 170551183
methyl 4-[[(2S)-2-[4-[(2-chloro-7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)amino]phenyl]-3,3,3-trifluoropropyl]carbamoyl]cyclohexane-1-carboxylate (PubChem CID 170551183) has the molecular formula C26H30ClF3N6O3 and a molecular weight of 567.01 g/mol. Its IUPAC name is methyl 4-[[(2S)-2-[4-[(2-chloro-7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)amino]phenyl]-3,3,3-trifluoropropyl]carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[(2S)-2-[4-[(2-chloro-7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)amino]phenyl]-3,3,3-trifluoropropyl]carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 170551183 |
| Molecular Formula | C26H30ClF3N6O3 |
| Molecular Weight | 567.01 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | methyl 4-[[(2S)-2-[4-[(2-chloro-7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)amino]phenyl]-3,3,3-trifluoropropyl]carbamoyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(C(=O)NC[C@H](c2ccc(Nc3cnc4nc(Cl)nn4c3C(C)C)cc2)C(F)(F)F)CC1 |
| InChI | InChI=1S/C26H30ClF3N6O3/c1-14(2)21-20(13-32-25-34-24(27)35-36(21)25)33-18-10-8-15(9-11-18)19(26(28,29)30)12-31-22(37)16-4-6-17(7-5-16)23(38)39-3/h8-11,13-14,16-17,19,33H,4-7,12H2,1-3H3,(H,31,37)/t16?,17?,19-/m1/s1 |
| InChIKey | XAEFWMFDJBWGIU-FAFZWHIHSA-N |
| XLogP | 5.39 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.01 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |