C28H30ClN5O4 — CID 170551255
(1R,4R)-1-tert-butyl-5-[2-[(E)-[2-(5-chloro-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 170551255) has the molecular formula C28H30ClN5O4 and a molecular weight of 536.03 g/mol. Its IUPAC name is (1R,4R)-1-tert-butyl-5-[2-[(E)-[2-(5-chloro-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1R,4R)-1-tert-butyl-5-[2-[(E)-[2-(5-chloro-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 170551255 |
| Molecular Formula | C28H30ClN5O4 |
| Molecular Weight | 536.03 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | (1R,4R)-1-tert-butyl-5-[2-[(E)-[2-(5-chloro-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CC(C)(C)[C@@]12C[C@H](CN1C(=O)O)N(CCO/N=C1/C(c3c(O)[nH]c4ccc(Cl)cc34)=Nc3ccccc31)C2 |
| InChI | InChI=1S/C28H30ClN5O4/c1-27(2,3)28-13-17(14-34(28)26(36)37)33(15-28)10-11-38-32-23-18-6-4-5-7-20(18)30-24(23)22-19-12-16(29)8-9-21(19)31-25(22)35/h4-9,12,17,31,35H,10-11,13-15H2,1-3H3,(H,36,37)/b32-23+/t17-,28+/m1/s1 |
| InChIKey | KAAFZHJPYPUJMJ-DHUKZKIJSA-N |
| XLogP | 5.23 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.03 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|