C21H17NO3 — CID 170551609
6'-ethyl-2-methylspiro[isoquinoline-4,4'-naphthalene]-1,1',3-trione (PubChem CID 170551609) has the molecular formula C21H17NO3 and a molecular weight of 331.37 g/mol. Its IUPAC name is 6'-ethyl-2-methylspiro[isoquinoline-4,4'-naphthalene]-1,1',3-trione.
| Compound Name | 6'-ethyl-2-methylspiro[isoquinoline-4,4'-naphthalene]-1,1',3-trione |
|---|---|
| PubChem CID | 170551609 |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 6'-ethyl-2-methylspiro[isoquinoline-4,4'-naphthalene]-1,1',3-trione |
| SMILES | CCc1ccc2c(c1)C1(C=CC2=O)C(=O)N(C)C(=O)c2ccccc21 |
| InChI | InChI=1S/C21H17NO3/c1-3-13-8-9-14-17(12-13)21(11-10-18(14)23)16-7-5-4-6-15(16)19(24)22(2)20(21)25/h4-12H,3H2,1-2H3 |
| InChIKey | IRLIHPROLBFHCE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|