C19H12FNO3 — CID 170551613
6'-fluoro-2-methylspiro[isoquinoline-4,4'-naphthalene]-1,1',3-trione (PubChem CID 170551613) has the molecular formula C19H12FNO3 and a molecular weight of 321.31 g/mol. Its IUPAC name is 6'-fluoro-2-methylspiro[isoquinoline-4,4'-naphthalene]-1,1',3-trione.
| Compound Name | 6'-fluoro-2-methylspiro[isoquinoline-4,4'-naphthalene]-1,1',3-trione |
|---|---|
| PubChem CID | 170551613 |
| Molecular Formula | C19H12FNO3 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 6'-fluoro-2-methylspiro[isoquinoline-4,4'-naphthalene]-1,1',3-trione |
| SMILES | CN1C(=O)c2ccccc2C2(C=CC(=O)c3ccc(F)cc32)C1=O |
| InChI | InChI=1S/C19H12FNO3/c1-21-17(23)13-4-2-3-5-14(13)19(18(21)24)9-8-16(22)12-7-6-11(20)10-15(12)19/h2-10H,1H3 |
| InChIKey | DLYZFHUBNMUBKC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|