C27H21NO — CID 170551705
(NE)-N-[[4-(1,2,2-triphenylethenyl)phenyl]methylidene]hydroxylamine (PubChem CID 170551705) has the molecular formula C27H21NO and a molecular weight of 375.47 g/mol. Its IUPAC name is (NE)-N-[[4-(1,2,2-triphenylethenyl)phenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[4-(1,2,2-triphenylethenyl)phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 170551705 |
| Molecular Formula | C27H21NO |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (NE)-N-[[4-(1,2,2-triphenylethenyl)phenyl]methylidene]hydroxylamine |
| SMILES | O/N=C/c1ccc(C(=C(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H21NO/c29-28-20-21-16-18-25(19-17-21)27(24-14-8-3-9-15-24)26(22-10-4-1-5-11-22)23-12-6-2-7-13-23/h1-20,29H/b28-20+ |
| InChIKey | RHDSUAHZUBXVKG-VFCFBJKWSA-N |
| XLogP | 6.50 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|