About propan-2-yl 4,4-dichlorocyclohexa-1,5-diene-1-carboxylate
propan-2-yl 4,4-dichlorocyclohexa-1,5-diene-1-carboxylate (PubChem CID 170551789) has the molecular formula C10H12Cl2O2
and a molecular weight of 235.11 g/mol. Its IUPAC name is propan-2-yl 4,4-dichlorocyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 4,4-dichlorocyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 170551789 |
| Molecular Formula | C10H12Cl2O2 |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | propan-2-yl 4,4-dichlorocyclohexa-1,5-diene-1-carboxylate |
| SMILES | CC(C)OC(=O)C1=CCC(Cl)(Cl)C=C1 |
| InChI | InChI=1S/C10H12Cl2O2/c1-7(2)14-9(13)8-3-5-10(11,12)6-4-8/h3-5,7H,6H2,1-2H3 |
| InChIKey | CKSNIROQXDYCBE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 4,4-dichlorocyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 4,4-dichlorocyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of propan-2-yl 4,4-dichlorocyclohexa-1,5-diene-1-carboxylate (CID 170551789) is propan-2-yl 4,4-dichlorocyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for propan-2-yl 4,4-dichlorocyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for propan-2-yl 4,4-dichlorocyclohexa-1,5-diene-1-carboxylate is CC(C)OC(=O)C1=CCC(Cl)(Cl)C=C1.
What is the InChIKey of propan-2-yl 4,4-dichlorocyclohexa-1,5-diene-1-carboxylate?
The InChIKey is CKSNIROQXDYCBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Cl2O2/c1-7(2)14-9(13)8-3-5-10(11,12)6-4-8/h3-5,7H,6H2,1-2H3.
What are the key properties of propan-2-yl 4,4-dichlorocyclohexa-1,5-diene-1-carboxylate?
propan-2-yl 4,4-dichlorocyclohexa-1,5-diene-1-carboxylate has a molecular weight of 235.11 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4,4-dichlorocyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 170551789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).