C10H8N2O3 — CID 170552158
8,9-dihydro-1H-furo[2,3-h]quinazoline-2,4-dione (PubChem CID 170552158) has the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. Its IUPAC name is 8,9-dihydro-1H-furo[2,3-h]quinazoline-2,4-dione.
| Compound Name | 8,9-dihydro-1H-furo[2,3-h]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 170552158 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 8,9-dihydro-1H-furo[2,3-h]quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2ccc3c(c2[nH]1)CCO3 |
| InChI | InChI=1S/C10H8N2O3/c13-9-6-1-2-7-5(3-4-15-7)8(6)11-10(14)12-9/h1-2H,3-4H2,(H2,11,12,13,14) |
| InChIKey | HJIJDKSQYZVUCY-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |