C10H7NO3 — CID 170552190
3,8-dihydro-2H-furo[3,2-g]indole-6,7-dione (PubChem CID 170552190) has the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. Its IUPAC name is 3,8-dihydro-2H-furo[3,2-g]indole-6,7-dione.
| Compound Name | 3,8-dihydro-2H-furo[3,2-g]indole-6,7-dione |
|---|---|
| PubChem CID | 170552190 |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 3,8-dihydro-2H-furo[3,2-g]indole-6,7-dione |
| SMILES | O=C1Nc2c(ccc3c2OCC3)C1=O |
| InChI | InChI=1S/C10H7NO3/c12-8-6-2-1-5-3-4-14-9(5)7(6)11-10(8)13/h1-2H,3-4H2,(H,11,12,13) |
| InChIKey | IMVBQIMAILBOCD-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|