About 9-benzyl-2,7-dichloro-9H-fluorene
9-benzyl-2,7-dichloro-9H-fluorene (PubChem CID 170552578) has the molecular formula C20H14Cl2
and a molecular weight of 325.24 g/mol. Its IUPAC name is 9-benzyl-2,7-dichloro-9H-fluorene.
Molecular Properties
| Compound Name | 9-benzyl-2,7-dichloro-9H-fluorene |
| PubChem CID | 170552578 |
| Molecular Formula | C20H14Cl2 |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 9-benzyl-2,7-dichloro-9H-fluorene |
| SMILES | Clc1ccc2c(c1)C(Cc1ccccc1)c1cc(Cl)ccc1-2 |
| InChI | InChI=1S/C20H14Cl2/c21-14-6-8-16-17-9-7-15(22)12-20(17)18(19(16)11-14)10-13-4-2-1-3-5-13/h1-9,11-12,18H,10H2 |
| InChIKey | IXJWDTNKDVPLOK-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9-benzyl-2,7-dichloro-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-benzyl-2,7-dichloro-9H-fluorene?
The IUPAC name of 9-benzyl-2,7-dichloro-9H-fluorene (CID 170552578) is 9-benzyl-2,7-dichloro-9H-fluorene.
What is the SMILES notation for 9-benzyl-2,7-dichloro-9H-fluorene?
The canonical SMILES for 9-benzyl-2,7-dichloro-9H-fluorene is Clc1ccc2c(c1)C(Cc1ccccc1)c1cc(Cl)ccc1-2.
What is the InChIKey of 9-benzyl-2,7-dichloro-9H-fluorene?
The InChIKey is IXJWDTNKDVPLOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14Cl2/c21-14-6-8-16-17-9-7-15(22)12-20(17)18(19(16)11-14)10-13-4-2-1-3-5-13/h1-9,11-12,18H,10H2.
What are the key properties of 9-benzyl-2,7-dichloro-9H-fluorene?
9-benzyl-2,7-dichloro-9H-fluorene has a molecular weight of 325.24 g/mol, XLogP of 6.35, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-benzyl-2,7-dichloro-9H-fluorene is sourced from PubChem (CID 170552578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).