C7H10KNO2S2 — CID 170552790
potassium 1,1-bis(ethenoxy)ethyl-dithiocarboxyazanide (PubChem CID 170552790) has the molecular formula C7H10KNO2S2 and a molecular weight of 243.39 g/mol. Its IUPAC name is potassium 1,1-bis(ethenoxy)ethyl-dithiocarboxyazanide.
| Compound Name | potassium 1,1-bis(ethenoxy)ethyl-dithiocarboxyazanide |
|---|---|
| PubChem CID | 170552790 |
| Molecular Formula | C7H10KNO2S2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 242.98 |
| IUPAC Name | potassium 1,1-bis(ethenoxy)ethyl-dithiocarboxyazanide |
| SMILES | C=COC(C)([N-]C(=S)S)OC=C.[K+] |
| InChI | InChI=1S/C7H11NO2S2.K/c1-4-9-7(3,10-5-2)8-6(11)12;/h4-5H,1-2H2,3H3,(H2,8,11,12);/q;+1/p-1 |
| InChIKey | QCQNAQAJJMKAKN-UHFFFAOYSA-M |
| XLogP | -0.43 |
| TPSA | 32.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|