C23H31BN2O2 — CID 170553385
(3-methylphenyl)-dioxidoborane;bis(2,4,6-trimethylpyridin-1-ium) (PubChem CID 170553385) has the molecular formula C23H31BN2O2 and a molecular weight of 378.33 g/mol. Its IUPAC name is (3-methylphenyl)-dioxidoborane;bis(2,4,6-trimethylpyridin-1-ium).
| Compound Name | (3-methylphenyl)-dioxidoborane;bis(2,4,6-trimethylpyridin-1-ium) |
|---|---|
| PubChem CID | 170553385 |
| Molecular Formula | C23H31BN2O2 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | (3-methylphenyl)-dioxidoborane;bis(2,4,6-trimethylpyridin-1-ium) |
| SMILES | Cc1cc(C)[nH+]c(C)c1.Cc1cc(C)[nH+]c(C)c1.Cc1cccc(B([O-])[O-])c1 |
| InChI | InChI=1S/2C8H11N.C7H7BO2/c2*1-6-4-7(2)9-8(3)5-6;1-6-3-2-4-7(5-6)8(9)10/h2*4-5H,1-3H3;2-5H,1H3/q;;-2/p+2 |
| InChIKey | AIMHLWGULBPFEN-UHFFFAOYSA-P |
| XLogP | 1.26 |
| TPSA | 74.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|