About CID 170554355
CID 170554355 (PubChem CID 170554355) has the molecular formula C10H17O4Si
and a molecular weight of 229.33 g/mol.
Molecular Properties
| Compound Name | CID 170554355 |
| PubChem CID | 170554355 |
| Molecular Formula | C10H17O4Si |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | — |
| SMILES | CC(=O)O[Si](C)C(C1COC1)C1COC1 |
| InChI | InChI=1S/C10H17O4Si/c1-7(11)14-15(2)10(8-3-12-4-8)9-5-13-6-9/h8-10H,3-6H2,1-2H3 |
| InChIKey | NVOQPCISTVQTSE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 170554355 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170554355?
The IUPAC name of CID 170554355 (CID 170554355) is not available.
What is the SMILES notation for CID 170554355?
The canonical SMILES for CID 170554355 is CC(=O)O[Si](C)C(C1COC1)C1COC1.
What is the InChIKey of CID 170554355?
The InChIKey is NVOQPCISTVQTSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17O4Si/c1-7(11)14-15(2)10(8-3-12-4-8)9-5-13-6-9/h8-10H,3-6H2,1-2H3.
What are the key properties of CID 170554355?
CID 170554355 has a molecular weight of 229.33 g/mol, XLogP of 0.83, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170554355 is sourced from PubChem (CID 170554355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).