C13H21NO4 — CID 170554381
2,6-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-dihydropyridine-6-carboxylic acid (PubChem CID 170554381) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 2,6-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-dihydropyridine-6-carboxylic acid.
| Compound Name | 2,6-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-dihydropyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 170554381 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 2,6-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-dihydropyridine-6-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)C1(C)CC=CC(C)(C(=O)O)N1 |
| InChI | InChI=1S/C13H21NO4/c1-11(2,3)18-10(17)13(5)8-6-7-12(4,14-13)9(15)16/h6-7,14H,8H2,1-5H3,(H,15,16) |
| InChIKey | QSBSDGJYSYXUEL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|