C15H21BrN2O — CID 170554890
(9aR)-8-(4-bromophenyl)-3,3-dimethyl-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine (PubChem CID 170554890) has the molecular formula C15H21BrN2O and a molecular weight of 325.25 g/mol. Its IUPAC name is (9aR)-8-(4-bromophenyl)-3,3-dimethyl-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine.
| Compound Name | (9aR)-8-(4-bromophenyl)-3,3-dimethyl-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 170554890 |
| Molecular Formula | C15H21BrN2O |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | (9aR)-8-(4-bromophenyl)-3,3-dimethyl-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine |
| SMILES | CC1(C)CN2CCN(c3ccc(Br)cc3)C[C@@H]2CO1 |
| InChI | InChI=1S/C15H21BrN2O/c1-15(2)11-18-8-7-17(9-14(18)10-19-15)13-5-3-12(16)4-6-13/h3-6,14H,7-11H2,1-2H3/t14-/m1/s1 |
| InChIKey | YDMBPMZDEQEVAM-CQSZACIVSA-N |
| XLogP | 2.75 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |