About N-tert-butyl-2,2-difluoro-4-[(1S)-4-methyl-5-oxocyclohex-3-en-1-yl]pent-4-enamide
N-tert-butyl-2,2-difluoro-4-[(1S)-4-methyl-5-oxocyclohex-3-en-1-yl]pent-4-enamide (PubChem CID 170555188) has the molecular formula C16H23F2NO2
and a molecular weight of 299.36 g/mol. Its IUPAC name is N-tert-butyl-2,2-difluoro-4-[(1S)-4-methyl-5-oxocyclohex-3-en-1-yl]pent-4-enamide.
Molecular Properties
| Compound Name | N-tert-butyl-2,2-difluoro-4-[(1S)-4-methyl-5-oxocyclohex-3-en-1-yl]pent-4-enamide |
| PubChem CID | 170555188 |
| Molecular Formula | C16H23F2NO2 |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | N-tert-butyl-2,2-difluoro-4-[(1S)-4-methyl-5-oxocyclohex-3-en-1-yl]pent-4-enamide |
| SMILES | C=C(CC(F)(F)C(=O)NC(C)(C)C)[C@H]1CC=C(C)C(=O)C1 |
| InChI | InChI=1S/C16H23F2NO2/c1-10-6-7-12(8-13(10)20)11(2)9-16(17,18)14(21)19-15(3,4)5/h6,12H,2,7-9H2,1,3-5H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | CEPSZSBLSZGYRA-LBPRGKRZSA-N |
| XLogP | 3.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-2,2-difluoro-4-[(1S)-4-methyl-5-oxocyclohex-3-en-1-yl]pent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2,2-difluoro-4-[(1S)-4-methyl-5-oxocyclohex-3-en-1-yl]pent-4-enamide?
The IUPAC name of N-tert-butyl-2,2-difluoro-4-[(1S)-4-methyl-5-oxocyclohex-3-en-1-yl]pent-4-enamide (CID 170555188) is N-tert-butyl-2,2-difluoro-4-[(1S)-4-methyl-5-oxocyclohex-3-en-1-yl]pent-4-enamide.
What is the SMILES notation for N-tert-butyl-2,2-difluoro-4-[(1S)-4-methyl-5-oxocyclohex-3-en-1-yl]pent-4-enamide?
The canonical SMILES for N-tert-butyl-2,2-difluoro-4-[(1S)-4-methyl-5-oxocyclohex-3-en-1-yl]pent-4-enamide is C=C(CC(F)(F)C(=O)NC(C)(C)C)[C@H]1CC=C(C)C(=O)C1.
What is the InChIKey of N-tert-butyl-2,2-difluoro-4-[(1S)-4-methyl-5-oxocyclohex-3-en-1-yl]pent-4-enamide?
The InChIKey is CEPSZSBLSZGYRA-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H23F2NO2/c1-10-6-7-12(8-13(10)20)11(2)9-16(17,18)14(21)19-15(3,4)5/h6,12H,2,7-9H2,1,3-5H3,(H,19,21)/t12-/m0/s1.
What are the key properties of N-tert-butyl-2,2-difluoro-4-[(1S)-4-methyl-5-oxocyclohex-3-en-1-yl]pent-4-enamide?
N-tert-butyl-2,2-difluoro-4-[(1S)-4-methyl-5-oxocyclohex-3-en-1-yl]pent-4-enamide has a molecular weight of 299.36 g/mol, XLogP of 3.41, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2,2-difluoro-4-[(1S)-4-methyl-5-oxocyclohex-3-en-1-yl]pent-4-enamide is sourced from PubChem (CID 170555188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).