About methyl 1-(4-bromophenyl)-2,4,5-triphenyl-2H-pyrrole-5-carboxylate
methyl 1-(4-bromophenyl)-2,4,5-triphenyl-2H-pyrrole-5-carboxylate (PubChem CID 170555311) has the molecular formula C30H24BrNO2
and a molecular weight of 510.43 g/mol. Its IUPAC name is methyl 1-(4-bromophenyl)-2,4,5-triphenyl-2H-pyrrole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(4-bromophenyl)-2,4,5-triphenyl-2H-pyrrole-5-carboxylate |
| PubChem CID | 170555311 |
| Molecular Formula | C30H24BrNO2 |
| Molecular Weight | 510.43 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | methyl 1-(4-bromophenyl)-2,4,5-triphenyl-2H-pyrrole-5-carboxylate |
| SMILES | COC(=O)C1(c2ccccc2)C(c2ccccc2)=CC(c2ccccc2)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C30H24BrNO2/c1-34-29(33)30(24-15-9-4-10-16-24)27(22-11-5-2-6-12-22)21-28(23-13-7-3-8-14-23)32(30)26-19-17-25(31)18-20-26/h2-21,28H,1H3 |
| InChIKey | QOBNGNJOXSODBB-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.43 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 1-(4-bromophenyl)-2,4,5-triphenyl-2H-pyrrole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(4-bromophenyl)-2,4,5-triphenyl-2H-pyrrole-5-carboxylate?
The IUPAC name of methyl 1-(4-bromophenyl)-2,4,5-triphenyl-2H-pyrrole-5-carboxylate (CID 170555311) is methyl 1-(4-bromophenyl)-2,4,5-triphenyl-2H-pyrrole-5-carboxylate.
What is the SMILES notation for methyl 1-(4-bromophenyl)-2,4,5-triphenyl-2H-pyrrole-5-carboxylate?
The canonical SMILES for methyl 1-(4-bromophenyl)-2,4,5-triphenyl-2H-pyrrole-5-carboxylate is COC(=O)C1(c2ccccc2)C(c2ccccc2)=CC(c2ccccc2)N1c1ccc(Br)cc1.
What is the InChIKey of methyl 1-(4-bromophenyl)-2,4,5-triphenyl-2H-pyrrole-5-carboxylate?
The InChIKey is QOBNGNJOXSODBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24BrNO2/c1-34-29(33)30(24-15-9-4-10-16-24)27(22-11-5-2-6-12-22)21-28(23-13-7-3-8-14-23)32(30)26-19-17-25(31)18-20-26/h2-21,28H,1H3.
What are the key properties of methyl 1-(4-bromophenyl)-2,4,5-triphenyl-2H-pyrrole-5-carboxylate?
methyl 1-(4-bromophenyl)-2,4,5-triphenyl-2H-pyrrole-5-carboxylate has a molecular weight of 510.43 g/mol, XLogP of 7.16, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(4-bromophenyl)-2,4,5-triphenyl-2H-pyrrole-5-carboxylate is sourced from PubChem (CID 170555311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).