About CID 170555389
CID 170555389 (PubChem CID 170555389) has the molecular formula C9H20OSi2
and a molecular weight of 200.43 g/mol.
Molecular Properties
| Compound Name | CID 170555389 |
| PubChem CID | 170555389 |
| Molecular Formula | C9H20OSi2 |
| Molecular Weight | 200.43 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | — |
| SMILES | C=C[Si](C)(C)CC[Si]C(C)(C)O |
| InChI | InChI=1S/C9H20OSi2/c1-6-12(4,5)8-7-11-9(2,3)10/h6,10H,1,7-8H2,2-5H3 |
| InChIKey | KEVTZZSCAVCYJF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 170555389 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170555389?
The IUPAC name of CID 170555389 (CID 170555389) is not available.
What is the SMILES notation for CID 170555389?
The canonical SMILES for CID 170555389 is C=C[Si](C)(C)CC[Si]C(C)(C)O.
What is the InChIKey of CID 170555389?
The InChIKey is KEVTZZSCAVCYJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20OSi2/c1-6-12(4,5)8-7-11-9(2,3)10/h6,10H,1,7-8H2,2-5H3.
What are the key properties of CID 170555389?
CID 170555389 has a molecular weight of 200.43 g/mol, XLogP of 2.27, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170555389 is sourced from PubChem (CID 170555389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).