About 6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-7-amine
6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-7-amine (PubChem CID 170555630) has the molecular formula C5H8N4
and a molecular weight of 124.15 g/mol. Its IUPAC name is 6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-7-amine.
Analyze 6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-7-amine?
The IUPAC name of 6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-7-amine (CID 170555630) is 6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-7-amine.
What is the SMILES notation for 6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-7-amine?
The canonical SMILES for 6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-7-amine is NC1CCn2ncnc21.
What is the InChIKey of 6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-7-amine?
The InChIKey is WJZYOZKSZMAKHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4/c6-4-1-2-9-5(4)7-3-8-9/h3-4H,1-2,6H2.
What are the key properties of 6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-7-amine?
6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-7-amine has a molecular weight of 124.15 g/mol, XLogP of -0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-7-amine is sourced from PubChem (CID 170555630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).