C8H7F3N2 — CID 170556194
5-diazo-6-(2,2,2-trifluoroethyl)cyclohexa-1,3-diene (PubChem CID 170556194) has the molecular formula C8H7F3N2 and a molecular weight of 188.15 g/mol. Its IUPAC name is 5-diazo-6-(2,2,2-trifluoroethyl)cyclohexa-1,3-diene.
| Compound Name | 5-diazo-6-(2,2,2-trifluoroethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 170556194 |
| Molecular Formula | C8H7F3N2 |
| Molecular Weight | 188.15 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 5-diazo-6-(2,2,2-trifluoroethyl)cyclohexa-1,3-diene |
| SMILES | [N-]=[N+]=C1C=CC=CC1CC(F)(F)F |
| InChI | InChI=1S/C8H7F3N2/c9-8(10,11)5-6-3-1-2-4-7(6)13-12/h1-4,6H,5H2 |
| InChIKey | KRZDVVVXIVWWBO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.15 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|