About bis(N-tert-butyl-N-(ethyliminomethyl)-2-methylpropan-2-amine);nickel(2+)
bis(N-tert-butyl-N-(ethyliminomethyl)-2-methylpropan-2-amine);nickel(2+) (PubChem CID 170556263) has the molecular formula C22H46N4Ni
and a molecular weight of 425.33 g/mol. Its IUPAC name is bis(N-tert-butyl-N-(ethyliminomethyl)-2-methylpropan-2-amine);nickel(2+).
Molecular Properties
| Compound Name | bis(N-tert-butyl-N-(ethyliminomethyl)-2-methylpropan-2-amine);nickel(2+) |
| PubChem CID | 170556263 |
| Molecular Formula | C22H46N4Ni |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 424.31 |
| IUPAC Name | bis(N-tert-butyl-N-(ethyliminomethyl)-2-methylpropan-2-amine);nickel(2+) |
| SMILES | CC/N=[C-]/N(C(C)(C)C)C(C)(C)C.CC/N=[C-]\N(C(C)(C)C)C(C)(C)C.[Ni+2] |
| InChI | InChI=1S/2C11H23N2.Ni/c2*1-8-12-9-13(10(2,3)4)11(5,6)7;/h2*8H2,1-7H3;/q2*-1;+2 |
| InChIKey | CREHDMYKXJADNN-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze bis(N-tert-butyl-N-(ethyliminomethyl)-2-methylpropan-2-amine);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-tert-butyl-N-(ethyliminomethyl)-2-methylpropan-2-amine);nickel(2+)?
The IUPAC name of bis(N-tert-butyl-N-(ethyliminomethyl)-2-methylpropan-2-amine);nickel(2+) (CID 170556263) is bis(N-tert-butyl-N-(ethyliminomethyl)-2-methylpropan-2-amine);nickel(2+).
What is the SMILES notation for bis(N-tert-butyl-N-(ethyliminomethyl)-2-methylpropan-2-amine);nickel(2+)?
The canonical SMILES for bis(N-tert-butyl-N-(ethyliminomethyl)-2-methylpropan-2-amine);nickel(2+) is CC/N=[C-]/N(C(C)(C)C)C(C)(C)C.CC/N=[C-]\N(C(C)(C)C)C(C)(C)C.[Ni+2].
What is the InChIKey of bis(N-tert-butyl-N-(ethyliminomethyl)-2-methylpropan-2-amine);nickel(2+)?
The InChIKey is CREHDMYKXJADNN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H23N2.Ni/c2*1-8-12-9-13(10(2,3)4)11(5,6)7;/h2*8H2,1-7H3;/q2*-1;+2.
What are the key properties of bis(N-tert-butyl-N-(ethyliminomethyl)-2-methylpropan-2-amine);nickel(2+)?
bis(N-tert-butyl-N-(ethyliminomethyl)-2-methylpropan-2-amine);nickel(2+) has a molecular weight of 425.33 g/mol, XLogP of 5.62, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-tert-butyl-N-(ethyliminomethyl)-2-methylpropan-2-amine);nickel(2+) is sourced from PubChem (CID 170556263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).