C23H34BN3O2 — CID 170556482
3-[1-(cyclohexylmethyl)-3,5-dimethylpyrazol-4-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 170556482) has the molecular formula C23H34BN3O2 and a molecular weight of 395.36 g/mol. Its IUPAC name is 3-[1-(cyclohexylmethyl)-3,5-dimethylpyrazol-4-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 3-[1-(cyclohexylmethyl)-3,5-dimethylpyrazol-4-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 170556482 |
| Molecular Formula | C23H34BN3O2 |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | 3-[1-(cyclohexylmethyl)-3,5-dimethylpyrazol-4-yl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | Cc1nn(CC2CCCCC2)c(C)c1-c1cncc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C23H34BN3O2/c1-16-21(17(2)27(26-16)15-18-10-8-7-9-11-18)19-12-20(14-25-13-19)24-28-22(3,4)23(5,6)29-24/h12-14,18H,7-11,15H2,1-6H3 |
| InChIKey | GFQFCBVWBCRDGN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|