C21H29BN2O2 — CID 170556507
1-(cyclopropylmethyl)-3,5-dimethyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole (PubChem CID 170556507) has the molecular formula C21H29BN2O2 and a molecular weight of 352.29 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3,5-dimethyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole.
| Compound Name | 1-(cyclopropylmethyl)-3,5-dimethyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole |
|---|---|
| PubChem CID | 170556507 |
| Molecular Formula | C21H29BN2O2 |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 1-(cyclopropylmethyl)-3,5-dimethyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazole |
| SMILES | Cc1nn(CC2CC2)c(C)c1-c1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C21H29BN2O2/c1-14-19(15(2)24(23-14)13-16-10-11-16)17-8-7-9-18(12-17)22-25-20(3,4)21(5,6)26-22/h7-9,12,16H,10-11,13H2,1-6H3 |
| InChIKey | YZVVHHPMUUUZMM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|