About 4-(3,4,5-trimethoxyphenyl)-1,2-benzoxazole
4-(3,4,5-trimethoxyphenyl)-1,2-benzoxazole (PubChem CID 170556515) has the molecular formula C16H15NO4
and a molecular weight of 285.30 g/mol. Its IUPAC name is 4-(3,4,5-trimethoxyphenyl)-1,2-benzoxazole.
Molecular Properties
| Compound Name | 4-(3,4,5-trimethoxyphenyl)-1,2-benzoxazole |
| PubChem CID | 170556515 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 4-(3,4,5-trimethoxyphenyl)-1,2-benzoxazole |
| SMILES | COc1cc(-c2cccc3oncc23)cc(OC)c1OC |
| InChI | InChI=1S/C16H15NO4/c1-18-14-7-10(8-15(19-2)16(14)20-3)11-5-4-6-13-12(11)9-17-21-13/h4-9H,1-3H3 |
| InChIKey | UVLXAURDPUXCCR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3,4,5-trimethoxyphenyl)-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4,5-trimethoxyphenyl)-1,2-benzoxazole?
The IUPAC name of 4-(3,4,5-trimethoxyphenyl)-1,2-benzoxazole (CID 170556515) is 4-(3,4,5-trimethoxyphenyl)-1,2-benzoxazole.
What is the SMILES notation for 4-(3,4,5-trimethoxyphenyl)-1,2-benzoxazole?
The canonical SMILES for 4-(3,4,5-trimethoxyphenyl)-1,2-benzoxazole is COc1cc(-c2cccc3oncc23)cc(OC)c1OC.
What is the InChIKey of 4-(3,4,5-trimethoxyphenyl)-1,2-benzoxazole?
The InChIKey is UVLXAURDPUXCCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO4/c1-18-14-7-10(8-15(19-2)16(14)20-3)11-5-4-6-13-12(11)9-17-21-13/h4-9H,1-3H3.
What are the key properties of 4-(3,4,5-trimethoxyphenyl)-1,2-benzoxazole?
4-(3,4,5-trimethoxyphenyl)-1,2-benzoxazole has a molecular weight of 285.30 g/mol, XLogP of 3.52, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4,5-trimethoxyphenyl)-1,2-benzoxazole is sourced from PubChem (CID 170556515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).