About (1S,4S)-4-azido-1-methyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene
(1S,4S)-4-azido-1-methyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene (PubChem CID 170556801) has the molecular formula C11H10F3N3O
and a molecular weight of 257.22 g/mol. Its IUPAC name is (1S,4S)-4-azido-1-methyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene.
Molecular Properties
| Compound Name | (1S,4S)-4-azido-1-methyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene |
| PubChem CID | 170556801 |
| Molecular Formula | C11H10F3N3O |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | (1S,4S)-4-azido-1-methyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene |
| SMILES | C[C@@H]1OC[C@@H](N=[N+]=[N-])c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C11H10F3N3O/c1-6-9-4-7(11(12,13)14)2-3-8(9)10(5-18-6)16-17-15/h2-4,6,10H,5H2,1H3/t6-,10+/m0/s1 |
| InChIKey | AWTPZRHYOHNGMU-QUBYGPBYSA-N |
| XLogP | 4.15 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (1S,4S)-4-azido-1-methyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4S)-4-azido-1-methyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene?
The IUPAC name of (1S,4S)-4-azido-1-methyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene (CID 170556801) is (1S,4S)-4-azido-1-methyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene.
What is the SMILES notation for (1S,4S)-4-azido-1-methyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene?
The canonical SMILES for (1S,4S)-4-azido-1-methyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene is C[C@@H]1OC[C@@H](N=[N+]=[N-])c2ccc(C(F)(F)F)cc21.
What is the InChIKey of (1S,4S)-4-azido-1-methyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene?
The InChIKey is AWTPZRHYOHNGMU-QUBYGPBYSA-N. The full InChI is InChI=1S/C11H10F3N3O/c1-6-9-4-7(11(12,13)14)2-3-8(9)10(5-18-6)16-17-15/h2-4,6,10H,5H2,1H3/t6-,10+/m0/s1.
What are the key properties of (1S,4S)-4-azido-1-methyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene?
(1S,4S)-4-azido-1-methyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene has a molecular weight of 257.22 g/mol, XLogP of 4.15, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4S)-4-azido-1-methyl-7-(trifluoromethyl)-3,4-dihydro-1H-isochromene is sourced from PubChem (CID 170556801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).