C24H23ClO4 — CID 170558387
(E)-1-[2-chloro-3,5-bis(methoxymethyl)phenyl]-3-(6-methoxynaphthalen-2-yl)prop-2-en-1-one (PubChem CID 170558387) has the molecular formula C24H23ClO4 and a molecular weight of 410.90 g/mol. Its IUPAC name is (E)-1-[2-chloro-3,5-bis(methoxymethyl)phenyl]-3-(6-methoxynaphthalen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[2-chloro-3,5-bis(methoxymethyl)phenyl]-3-(6-methoxynaphthalen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 170558387 |
| Molecular Formula | C24H23ClO4 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | (E)-1-[2-chloro-3,5-bis(methoxymethyl)phenyl]-3-(6-methoxynaphthalen-2-yl)prop-2-en-1-one |
| SMILES | COCc1cc(COC)c(Cl)c(C(=O)/C=C/c2ccc3cc(OC)ccc3c2)c1 |
| InChI | InChI=1S/C24H23ClO4/c1-27-14-17-11-20(15-28-2)24(25)22(12-17)23(26)9-5-16-4-6-19-13-21(29-3)8-7-18(19)10-16/h4-13H,14-15H2,1-3H3/b9-5+ |
| InChIKey | ILYPJHBBIUJQKI-WEVVVXLNSA-N |
| XLogP | 5.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|