C27H29FN2O5 — CID 170558449
(3aS,4S,5S,6aR)-2-[(2R)-2-(6-fluoro-5-phenylmethoxy-2-pyridinyl)-2-hydroxyethyl]-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a,4-diol (PubChem CID 170558449) has the molecular formula C27H29FN2O5 and a molecular weight of 480.54 g/mol. Its IUPAC name is (3aS,4S,5S,6aR)-2-[(2R)-2-(6-fluoro-5-phenylmethoxy-2-pyridinyl)-2-hydroxyethyl]-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a,4-diol.
| Compound Name | (3aS,4S,5S,6aR)-2-[(2R)-2-(6-fluoro-5-phenylmethoxy-2-pyridinyl)-2-hydroxyethyl]-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a,4-diol |
|---|---|
| PubChem CID | 170558449 |
| Molecular Formula | C27H29FN2O5 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | (3aS,4S,5S,6aR)-2-[(2R)-2-(6-fluoro-5-phenylmethoxy-2-pyridinyl)-2-hydroxyethyl]-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a,4-diol |
| SMILES | O[C@H](CN1C[C@H]2C[C@H](Oc3ccccc3)[C@H](O)[C@@]2(O)C1)c1ccc(OCc2ccccc2)c(F)n1 |
| InChI | InChI=1S/C27H29FN2O5/c28-26-23(34-16-18-7-3-1-4-8-18)12-11-21(29-26)22(31)15-30-14-19-13-24(25(32)27(19,33)17-30)35-20-9-5-2-6-10-20/h1-12,19,22,24-25,31-33H,13-17H2/t19-,22-,24+,25+,27-/m1/s1 |
| InChIKey | CTJYSEMDGOJKLR-ZZQHRCADSA-N |
| XLogP | 2.71 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|