C13H5F9IN — CID 170560421
4-[(E)-3,3,4,4,5,5,6,6,6-nonafluoro-1-iodohex-1-enyl]benzonitrile (PubChem CID 170560421) has the molecular formula C13H5F9IN and a molecular weight of 473.08 g/mol. Its IUPAC name is 4-[(E)-3,3,4,4,5,5,6,6,6-nonafluoro-1-iodohex-1-enyl]benzonitrile.
| Compound Name | 4-[(E)-3,3,4,4,5,5,6,6,6-nonafluoro-1-iodohex-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 170560421 |
| Molecular Formula | C13H5F9IN |
| Molecular Weight | 473.08 g/mol |
| Exact Mass | 472.93 |
| IUPAC Name | 4-[(E)-3,3,4,4,5,5,6,6,6-nonafluoro-1-iodohex-1-enyl]benzonitrile |
| SMILES | N#Cc1ccc(/C(I)=C\C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H5F9IN/c14-10(15,11(16,17)12(18,19)13(20,21)22)5-9(23)8-3-1-7(6-24)2-4-8/h1-5H/b9-5+ |
| InChIKey | DQHCOSFRNNEMDH-WEVVVXLNSA-N |
| XLogP | 5.80 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.08 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|