C36H52N6 — CID 170562428
N-[(1S,2S)-2-[di(piperidin-1-yl)methylideneamino]-1,2-diphenylethyl]-1,1-di(piperidin-1-yl)methanimine (PubChem CID 170562428) has the molecular formula C36H52N6 and a molecular weight of 568.85 g/mol. Its IUPAC name is N-[(1S,2S)-2-[di(piperidin-1-yl)methylideneamino]-1,2-diphenylethyl]-1,1-di(piperidin-1-yl)methanimine.
| Compound Name | N-[(1S,2S)-2-[di(piperidin-1-yl)methylideneamino]-1,2-diphenylethyl]-1,1-di(piperidin-1-yl)methanimine |
|---|---|
| PubChem CID | 170562428 |
| Molecular Formula | C36H52N6 |
| Molecular Weight | 568.85 g/mol |
| Exact Mass | 568.43 |
| IUPAC Name | N-[(1S,2S)-2-[di(piperidin-1-yl)methylideneamino]-1,2-diphenylethyl]-1,1-di(piperidin-1-yl)methanimine |
| SMILES | c1ccc([C@H](N=C(N2CCCCC2)N2CCCCC2)[C@@H](N=C(N2CCCCC2)N2CCCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H52N6/c1-7-19-31(20-8-1)33(37-35(39-23-11-3-12-24-39)40-25-13-4-14-26-40)34(32-21-9-2-10-22-32)38-36(41-27-15-5-16-28-41)42-29-17-6-18-30-42/h1-2,7-10,19-22,33-34H,3-6,11-18,23-30H2/t33-,34-/m0/s1 |
| InChIKey | XLVPJISHMZPCCG-HEVIKAOCSA-N |
| XLogP | 7.12 |
| TPSA | 37.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.85 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|