C12H10ClFN2O4 — CID 170562895
5-[[(2-chloro-3-fluoro-4-pyridinyl)amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 170562895) has the molecular formula C12H10ClFN2O4 and a molecular weight of 300.67 g/mol. Its IUPAC name is 5-[[(2-chloro-3-fluoro-4-pyridinyl)amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[(2-chloro-3-fluoro-4-pyridinyl)amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 170562895 |
| Molecular Formula | C12H10ClFN2O4 |
| Molecular Weight | 300.67 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 5-[[(2-chloro-3-fluoro-4-pyridinyl)amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=CNc2ccnc(Cl)c2F)C(=O)O1 |
| InChI | InChI=1S/C12H10ClFN2O4/c1-12(2)19-10(17)6(11(18)20-12)5-16-7-3-4-15-9(13)8(7)14/h3-5H,1-2H3,(H,15,16) |
| InChIKey | CHCPOHHTSUJPJY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.67 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|