C16H14N2O — CID 170563547
6a,7,8,9-tetrahydro-6H-quinolino[2,3-b]quinolin-10-one (PubChem CID 170563547) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is 6a,7,8,9-tetrahydro-6H-quinolino[2,3-b]quinolin-10-one.
| Compound Name | 6a,7,8,9-tetrahydro-6H-quinolino[2,3-b]quinolin-10-one |
|---|---|
| PubChem CID | 170563547 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 6a,7,8,9-tetrahydro-6H-quinolino[2,3-b]quinolin-10-one |
| SMILES | O=C1CCCC2Nc3nc4ccccc4cc3C=C12 |
| InChI | InChI=1S/C16H14N2O/c19-15-7-3-6-14-12(15)9-11-8-10-4-1-2-5-13(10)17-16(11)18-14/h1-2,4-5,8-9,14H,3,6-7H2,(H,17,18) |
| InChIKey | DATZDIPEPSBTLU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |